C40H75NO4 — CID 176916997
3,7-dimethyloct-6-enyl 10-[[10-(3,7-dimethyloct-6-enoxy)-10-oxodecyl]amino]decanoate (PubChem CID 176916997) has the molecular formula C40H75NO4 and a molecular weight of 634.04 g/mol. Its IUPAC name is 3,7-dimethyloct-6-enyl 10-[[10-(3,7-dimethyloct-6-enoxy)-10-oxodecyl]amino]decanoate.
| Compound Name | 3,7-dimethyloct-6-enyl 10-[[10-(3,7-dimethyloct-6-enoxy)-10-oxodecyl]amino]decanoate |
|---|---|
| PubChem CID | 176916997 |
| Molecular Formula | C40H75NO4 |
| Molecular Weight | 634.04 g/mol |
| Exact Mass | 633.57 |
| IUPAC Name | 3,7-dimethyloct-6-enyl 10-[[10-(3,7-dimethyloct-6-enoxy)-10-oxodecyl]amino]decanoate |
| SMILES | CC(C)=CCCC(C)CCOC(=O)CCCCCCCCCNCCCCCCCCCC(=O)OCCC(C)CCC=C(C)C |
| InChI | InChI=1S/C40H75NO4/c1-35(2)23-21-25-37(5)29-33-44-39(42)27-17-13-9-7-11-15-19-31-41-32-20-16-12-8-10-14-18-28-40(43)45-34-30-38(6)26-22-24-36(3)4/h23-24,37-38,41H,7-22,25-34H2,1-6H3 |
| InChIKey | VIXRSVPULZYXNO-UHFFFAOYSA-N |
| XLogP | 11.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.04 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|