C32H61NO5 — CID 176573285
6-(2-hydroxyethylamino)hexyl 4,4-bis(3,7-dimethyloct-6-enoxy)butanoate (PubChem CID 176573285) has the molecular formula C32H61NO5 and a molecular weight of 539.84 g/mol. Its IUPAC name is 6-(2-hydroxyethylamino)hexyl 4,4-bis(3,7-dimethyloct-6-enoxy)butanoate.
| Compound Name | 6-(2-hydroxyethylamino)hexyl 4,4-bis(3,7-dimethyloct-6-enoxy)butanoate |
|---|---|
| PubChem CID | 176573285 |
| Molecular Formula | C32H61NO5 |
| Molecular Weight | 539.84 g/mol |
| Exact Mass | 539.45 |
| IUPAC Name | 6-(2-hydroxyethylamino)hexyl 4,4-bis(3,7-dimethyloct-6-enoxy)butanoate |
| SMILES | CC(C)=CCCC(C)CCOC(CCC(=O)OCCCCCCNCCO)OCCC(C)CCC=C(C)C |
| InChI | InChI=1S/C32H61NO5/c1-27(2)13-11-15-29(5)19-25-37-32(38-26-20-30(6)16-12-14-28(3)4)18-17-31(35)36-24-10-8-7-9-21-33-22-23-34/h13-14,29-30,32-34H,7-12,15-26H2,1-6H3 |
| InChIKey | QSQVRGRXWYHMBS-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.84 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|