C46H83NO7 — CID 176573227
6-[2-hydroxyethyl-[4-oxo-4-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]butyl]amino]hexyl 4,4-bis(3,7-dimethyloct-6-enoxy)butanoate (PubChem CID 176573227) has the molecular formula C46H83NO7 and a molecular weight of 762.17 g/mol. Its IUPAC name is 6-[2-hydroxyethyl-[4-oxo-4-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]butyl]amino]hexyl 4,4-bis(3,7-dimethyloct-6-enoxy)butanoate.
| Compound Name | 6-[2-hydroxyethyl-[4-oxo-4-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]butyl]amino]hexyl 4,4-bis(3,7-dimethyloct-6-enoxy)butanoate |
|---|---|
| PubChem CID | 176573227 |
| Molecular Formula | C46H83NO7 |
| Molecular Weight | 762.17 g/mol |
| Exact Mass | 761.62 |
| IUPAC Name | 6-[2-hydroxyethyl-[4-oxo-4-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]butyl]amino]hexyl 4,4-bis(3,7-dimethyloct-6-enoxy)butanoate |
| SMILES | CC(C)=CCCC(C)CCOC(CCC(=O)OCCCCCCN(CCO)CCCC(=O)O[C@@H]1C[C@@H]2CC[C@@]1(C)C2(C)C)OCCC(C)CCC=C(C)C |
| InChI | InChI=1S/C46H83NO7/c1-36(2)17-14-19-38(5)25-33-52-44(53-34-26-39(6)20-15-18-37(3)4)23-22-42(49)51-32-13-11-10-12-28-47(30-31-48)29-16-21-43(50)54-41-35-40-24-27-46(41,9)45(40,7)8/h17-18,38-41,44,48H,10-16,19-35H2,1-9H3/t38?,39?,40-,41+,44?,46+/m0/s1 |
| InChIKey | SKMRXLOQTMZAEW-MYBCCOIYSA-N |
| XLogP | 10.61 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.17 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|