C48H95NO9 — CID 178070143
3,3-bis(3-methylhexoxy)propyl 6-[[6-[3,3-bis(3-methylhexoxy)propoxy]-6-oxohexyl]-(2-hydroxyethyl)amino]hexanoate (PubChem CID 178070143) has the molecular formula C48H95NO9 and a molecular weight of 830.29 g/mol. Its IUPAC name is 3,3-bis(3-methylhexoxy)propyl 6-[[6-[3,3-bis(3-methylhexoxy)propoxy]-6-oxohexyl]-(2-hydroxyethyl)amino]hexanoate.
| Compound Name | 3,3-bis(3-methylhexoxy)propyl 6-[[6-[3,3-bis(3-methylhexoxy)propoxy]-6-oxohexyl]-(2-hydroxyethyl)amino]hexanoate |
|---|---|
| PubChem CID | 178070143 |
| Molecular Formula | C48H95NO9 |
| Molecular Weight | 830.29 g/mol |
| Exact Mass | 829.70 |
| IUPAC Name | 3,3-bis(3-methylhexoxy)propyl 6-[[6-[3,3-bis(3-methylhexoxy)propoxy]-6-oxohexyl]-(2-hydroxyethyl)amino]hexanoate |
| SMILES | CCCC(C)CCOC(CCOC(=O)CCCCCN(CCO)CCCCCC(=O)OCCC(OCCC(C)CCC)OCCC(C)CCC)OCCC(C)CCC |
| InChI | InChI=1S/C48H95NO9/c1-9-19-41(5)25-35-55-47(56-36-26-42(6)20-10-2)29-39-53-45(51)23-15-13-17-31-49(33-34-50)32-18-14-16-24-46(52)54-40-30-48(57-37-27-43(7)21-11-3)58-38-28-44(8)22-12-4/h41-44,47-48,50H,9-40H2,1-8H3 |
| InChIKey | MVACYIPSVKIHED-UHFFFAOYSA-N |
| XLogP | 11.29 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.29 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|