C46H82N2O4S — CID 170937716
3-pentyloctyl 8-[[8-oxo-8-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]octyl]-[4-(1,3-thiazol-2-yl)butyl]amino]octanoate (PubChem CID 170937716) has the molecular formula C46H82N2O4S and a molecular weight of 759.24 g/mol. Its IUPAC name is 3-pentyloctyl 8-[[8-oxo-8-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]octyl]-[4-(1,3-thiazol-2-yl)butyl]amino]octanoate.
| Compound Name | 3-pentyloctyl 8-[[8-oxo-8-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]octyl]-[4-(1,3-thiazol-2-yl)butyl]amino]octanoate |
|---|---|
| PubChem CID | 170937716 |
| Molecular Formula | C46H82N2O4S |
| Molecular Weight | 759.24 g/mol |
| Exact Mass | 758.60 |
| IUPAC Name | 3-pentyloctyl 8-[[8-oxo-8-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]octyl]-[4-(1,3-thiazol-2-yl)butyl]amino]octanoate |
| SMILES | CCCCCC(CCCCC)CCOC(=O)CCCCCCCN(CCCCCCCC(=O)O[C@@H]1C[C@@H]2CC[C@@]1(C)C2(C)C)CCCCc1nccs1 |
| InChI | InChI=1S/C46H82N2O4S/c1-6-8-16-24-39(25-17-9-7-2)30-36-51-43(49)27-18-12-10-14-21-33-48(35-23-20-26-42-47-32-37-53-42)34-22-15-11-13-19-28-44(50)52-41-38-40-29-31-46(41,5)45(40,3)4/h32,37,39-41H,6-31,33-36,38H2,1-5H3/t40-,41+,46+/m0/s1 |
| InChIKey | MQHIFOOYXSXQOO-JSZQUTJJSA-N |
| XLogP | 12.92 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.24 |
| LogP ≤ 5 | 12.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|