C44H87NO4 — CID 178033109
1,1,2,2,3-pentamethylcyclopentane;3-pentyloctyl 8-[4-hydroxybutyl(8-hydroxynon-8-enyl)amino]octanoate (PubChem CID 178033109) has the molecular formula C44H87NO4 and a molecular weight of 694.18 g/mol. Its IUPAC name is 1,1,2,2,3-pentamethylcyclopentane;3-pentyloctyl 8-[4-hydroxybutyl(8-hydroxynon-8-enyl)amino]octanoate.
| Compound Name | 1,1,2,2,3-pentamethylcyclopentane;3-pentyloctyl 8-[4-hydroxybutyl(8-hydroxynon-8-enyl)amino]octanoate |
|---|---|
| PubChem CID | 178033109 |
| Molecular Formula | C44H87NO4 |
| Molecular Weight | 694.18 g/mol |
| Exact Mass | 693.66 |
| IUPAC Name | 1,1,2,2,3-pentamethylcyclopentane;3-pentyloctyl 8-[4-hydroxybutyl(8-hydroxynon-8-enyl)amino]octanoate |
| SMILES | C=C(O)CCCCCCCN(CCCCO)CCCCCCCC(=O)OCCC(CCCCC)CCCCC.CC1CCC(C)(C)C1(C)C |
| InChI | InChI=1S/C34H67NO4.C10H20/c1-4-6-14-23-33(24-15-7-5-2)26-31-39-34(38)25-17-11-9-13-19-28-35(29-20-21-30-36)27-18-12-8-10-16-22-32(3)37;1-8-6-7-9(2,3)10(8,4)5/h33,36-37H,3-31H2,1-2H3;8H,6-7H2,1-5H3 |
| InChIKey | OJMNCLRXTVODSZ-UHFFFAOYSA-N |
| XLogP | 12.99 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.18 |
| LogP ≤ 5 | 12.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|