C37H71NO5 — CID 178085117
3-pentyloctyl 8-[2-hydroxyethyl-[8-(3-methylcyclopentyl)oxy-8-oxooctyl]amino]octanoate (PubChem CID 178085117) has the molecular formula C37H71NO5 and a molecular weight of 609.98 g/mol. Its IUPAC name is 3-pentyloctyl 8-[2-hydroxyethyl-[8-(3-methylcyclopentyl)oxy-8-oxooctyl]amino]octanoate.
| Compound Name | 3-pentyloctyl 8-[2-hydroxyethyl-[8-(3-methylcyclopentyl)oxy-8-oxooctyl]amino]octanoate |
|---|---|
| PubChem CID | 178085117 |
| Molecular Formula | C37H71NO5 |
| Molecular Weight | 609.98 g/mol |
| Exact Mass | 609.53 |
| IUPAC Name | 3-pentyloctyl 8-[2-hydroxyethyl-[8-(3-methylcyclopentyl)oxy-8-oxooctyl]amino]octanoate |
| SMILES | CCCCCC(CCCCC)CCOC(=O)CCCCCCCN(CCO)CCCCCCCC(=O)OC1CCC(C)C1 |
| InChI | InChI=1S/C37H71NO5/c1-4-6-14-20-34(21-15-7-5-2)26-31-42-36(40)22-16-10-8-12-18-27-38(29-30-39)28-19-13-9-11-17-23-37(41)43-35-25-24-33(3)32-35/h33-35,39H,4-32H2,1-3H3 |
| InChIKey | WVRUDRALTBCWJA-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.98 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|