C48H93NO5 — CID 177221731
3-pentyloctyl 8-[[8-(3-hexyl-4-pentylcyclohexyl)oxy-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate (PubChem CID 177221731) has the molecular formula C48H93NO5 and a molecular weight of 764.27 g/mol. Its IUPAC name is 3-pentyloctyl 8-[[8-(3-hexyl-4-pentylcyclohexyl)oxy-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate.
| Compound Name | 3-pentyloctyl 8-[[8-(3-hexyl-4-pentylcyclohexyl)oxy-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate |
|---|---|
| PubChem CID | 177221731 |
| Molecular Formula | C48H93NO5 |
| Molecular Weight | 764.27 g/mol |
| Exact Mass | 763.71 |
| IUPAC Name | 3-pentyloctyl 8-[[8-(3-hexyl-4-pentylcyclohexyl)oxy-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate |
| SMILES | CCCCCCC1CC(OC(=O)CCCCCCCN(CCO)CCCCCCCC(=O)OCCC(CCCCC)CCCCC)CCC1CCCCC |
| InChI | InChI=1S/C48H93NO5/c1-5-9-13-23-31-45-42-46(35-34-44(45)30-22-12-8-4)54-48(52)33-25-17-15-19-27-38-49(39-40-50)37-26-18-14-16-24-32-47(51)53-41-36-43(28-20-10-6-2)29-21-11-7-3/h43-46,50H,5-42H2,1-4H3 |
| InChIKey | SYYRVVCHVFMGCA-UHFFFAOYSA-N |
| XLogP | 13.55 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.27 |
| LogP ≤ 5 | 13.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|