C23H45NO3 — CID 129232936
(4-pentylcyclohexyl) 7-[2-hydroxyethyl(propyl)amino]heptanoate (PubChem CID 129232936) has the molecular formula C23H45NO3 and a molecular weight of 383.62 g/mol. Its IUPAC name is (4-pentylcyclohexyl) 7-[2-hydroxyethyl(propyl)amino]heptanoate.
| Compound Name | (4-pentylcyclohexyl) 7-[2-hydroxyethyl(propyl)amino]heptanoate |
|---|---|
| PubChem CID | 129232936 |
| Molecular Formula | C23H45NO3 |
| Molecular Weight | 383.62 g/mol |
| Exact Mass | 383.34 |
| IUPAC Name | (4-pentylcyclohexyl) 7-[2-hydroxyethyl(propyl)amino]heptanoate |
| SMILES | CCCCCC1CCC(OC(=O)CCCCCCN(CCC)CCO)CC1 |
| InChI | InChI=1S/C23H45NO3/c1-3-5-8-11-21-13-15-22(16-14-21)27-23(26)12-9-6-7-10-18-24(17-4-2)19-20-25/h21-22,25H,3-20H2,1-2H3 |
| InChIKey | VFQROTSKJMQGKO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.62 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|