C28H53NO5 — CID 151488711
8-[[8-[(2-hexylcyclopropyl)methoxy]-8-oxooctyl]-(2-hydroxyethyl)amino]octanoic acid (PubChem CID 151488711) has the molecular formula C28H53NO5 and a molecular weight of 483.73 g/mol. Its IUPAC name is 8-[[8-[(2-hexylcyclopropyl)methoxy]-8-oxooctyl]-(2-hydroxyethyl)amino]octanoic acid.
| Compound Name | 8-[[8-[(2-hexylcyclopropyl)methoxy]-8-oxooctyl]-(2-hydroxyethyl)amino]octanoic acid |
|---|---|
| PubChem CID | 151488711 |
| Molecular Formula | C28H53NO5 |
| Molecular Weight | 483.73 g/mol |
| Exact Mass | 483.39 |
| IUPAC Name | 8-[[8-[(2-hexylcyclopropyl)methoxy]-8-oxooctyl]-(2-hydroxyethyl)amino]octanoic acid |
| SMILES | CCCCCCC1CC1COC(=O)CCCCCCCN(CCO)CCCCCCCC(=O)O |
| InChI | InChI=1S/C28H53NO5/c1-2-3-4-11-16-25-23-26(25)24-34-28(33)18-13-8-6-10-15-20-29(21-22-30)19-14-9-5-7-12-17-27(31)32/h25-26,30H,2-24H2,1H3,(H,31,32) |
| InChIKey | PNZSHQRGDUOLCH-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.73 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|