C39H73NO4 — CID 168962303
3-pentyloctyl 8-[[8-oxo-8-[[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]octyl]amino]octanoate (PubChem CID 168962303) has the molecular formula C39H73NO4 and a molecular weight of 620.02 g/mol. Its IUPAC name is 3-pentyloctyl 8-[[8-oxo-8-[[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]octyl]amino]octanoate.
| Compound Name | 3-pentyloctyl 8-[[8-oxo-8-[[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]octyl]amino]octanoate |
|---|---|
| PubChem CID | 168962303 |
| Molecular Formula | C39H73NO4 |
| Molecular Weight | 620.02 g/mol |
| Exact Mass | 619.55 |
| IUPAC Name | 3-pentyloctyl 8-[[8-oxo-8-[[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]octyl]amino]octanoate |
| SMILES | CCCCCC(CCCCC)CCOC(=O)CCCCCCCNCCCCCCCC(=O)O[C@H]1C[C@@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C39H73NO4/c1-6-8-16-22-33(23-17-9-7-2)27-31-43-36(41)24-18-12-10-14-20-29-40-30-21-15-11-13-19-25-37(42)44-35-32-34-26-28-39(35,5)38(34,3)4/h33-35,40H,6-32H2,1-5H3/t34-,35-,39+/m0/s1 |
| InChIKey | UQKZWYYUFLCAAV-CXUZTKPISA-N |
| XLogP | 10.73 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.02 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|