About 8-[8-(4-pentylnonanoyloxy)octylamino]octyl 4-pentylnonanoate
8-[8-(4-pentylnonanoyloxy)octylamino]octyl 4-pentylnonanoate (PubChem CID 168892165) has the molecular formula C44H87NO4
and a molecular weight of 694.18 g/mol. Its IUPAC name is 8-[8-(4-pentylnonanoyloxy)octylamino]octyl 4-pentylnonanoate.
Molecular Properties
| Compound Name | 8-[8-(4-pentylnonanoyloxy)octylamino]octyl 4-pentylnonanoate |
| PubChem CID | 168892165 |
| Molecular Formula | C44H87NO4 |
| Molecular Weight | 694.18 g/mol |
| Exact Mass | 693.66 |
| IUPAC Name | 8-[8-(4-pentylnonanoyloxy)octylamino]octyl 4-pentylnonanoate |
| SMILES | CCCCCC(CCCCC)CCC(=O)OCCCCCCCCNCCCCCCCCOC(=O)CCC(CCCCC)CCCCC |
| InChI | InChI=1S/C44H87NO4/c1-5-9-21-29-41(30-22-10-6-2)33-35-43(46)48-39-27-19-15-13-17-25-37-45-38-26-18-14-16-20-28-40-49-44(47)36-34-42(31-23-11-7-3)32-24-12-8-4/h41-42,45H,5-40H2,1-4H3 |
| InChIKey | XGZXJXHDYSSLJF-UHFFFAOYSA-N |
| XLogP | 13.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 694.18 |
| LogP ≤ 5 | 13.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-[8-(4-pentylnonanoyloxy)octylamino]octyl 4-pentylnonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[8-(4-pentylnonanoyloxy)octylamino]octyl 4-pentylnonanoate?
The IUPAC name of 8-[8-(4-pentylnonanoyloxy)octylamino]octyl 4-pentylnonanoate (CID 168892165) is 8-[8-(4-pentylnonanoyloxy)octylamino]octyl 4-pentylnonanoate.
What is the SMILES notation for 8-[8-(4-pentylnonanoyloxy)octylamino]octyl 4-pentylnonanoate?
The canonical SMILES for 8-[8-(4-pentylnonanoyloxy)octylamino]octyl 4-pentylnonanoate is CCCCCC(CCCCC)CCC(=O)OCCCCCCCCNCCCCCCCCOC(=O)CCC(CCCCC)CCCCC.
What is the InChIKey of 8-[8-(4-pentylnonanoyloxy)octylamino]octyl 4-pentylnonanoate?
The InChIKey is XGZXJXHDYSSLJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C44H87NO4/c1-5-9-21-29-41(30-22-10-6-2)33-35-43(46)48-39-27-19-15-13-17-25-37-45-38-26-18-14-16-20-28-40-49-44(47)36-34-42(31-23-11-7-3)32-24-12-8-4/h41-42,45H,5-40H2,1-4H3.
What are the key properties of 8-[8-(4-pentylnonanoyloxy)octylamino]octyl 4-pentylnonanoate?
8-[8-(4-pentylnonanoyloxy)octylamino]octyl 4-pentylnonanoate has a molecular weight of 694.18 g/mol, XLogP of 13.46, 40 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[8-(4-pentylnonanoyloxy)octylamino]octyl 4-pentylnonanoate is sourced from PubChem (CID 168892165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).