About 9-[3-(4-methylpentylamino)propanoyloxy]nonyl 3-(hexylamino)propanoate
9-[3-(4-methylpentylamino)propanoyloxy]nonyl 3-(hexylamino)propanoate (PubChem CID 91449159) has the molecular formula C27H54N2O4
and a molecular weight of 470.74 g/mol. Its IUPAC name is 9-[3-(4-methylpentylamino)propanoyloxy]nonyl 3-(hexylamino)propanoate.
Molecular Properties
| Compound Name | 9-[3-(4-methylpentylamino)propanoyloxy]nonyl 3-(hexylamino)propanoate |
| PubChem CID | 91449159 |
| Molecular Formula | C27H54N2O4 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 470.41 |
| IUPAC Name | 9-[3-(4-methylpentylamino)propanoyloxy]nonyl 3-(hexylamino)propanoate |
| SMILES | CCCCCCNCCC(=O)OCCCCCCCCCOC(=O)CCNCCCC(C)C |
| InChI | InChI=1S/C27H54N2O4/c1-4-5-6-12-19-28-21-17-26(30)32-23-13-10-8-7-9-11-14-24-33-27(31)18-22-29-20-15-16-25(2)3/h25,28-29H,4-24H2,1-3H3 |
| InChIKey | SETYEQRLYMEAHZ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-[3-(4-methylpentylamino)propanoyloxy]nonyl 3-(hexylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[3-(4-methylpentylamino)propanoyloxy]nonyl 3-(hexylamino)propanoate?
The IUPAC name of 9-[3-(4-methylpentylamino)propanoyloxy]nonyl 3-(hexylamino)propanoate (CID 91449159) is 9-[3-(4-methylpentylamino)propanoyloxy]nonyl 3-(hexylamino)propanoate.
What is the SMILES notation for 9-[3-(4-methylpentylamino)propanoyloxy]nonyl 3-(hexylamino)propanoate?
The canonical SMILES for 9-[3-(4-methylpentylamino)propanoyloxy]nonyl 3-(hexylamino)propanoate is CCCCCCNCCC(=O)OCCCCCCCCCOC(=O)CCNCCCC(C)C.
What is the InChIKey of 9-[3-(4-methylpentylamino)propanoyloxy]nonyl 3-(hexylamino)propanoate?
The InChIKey is SETYEQRLYMEAHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H54N2O4/c1-4-5-6-12-19-28-21-17-26(30)32-23-13-10-8-7-9-11-14-24-33-27(31)18-22-29-20-15-16-25(2)3/h25,28-29H,4-24H2,1-3H3.
What are the key properties of 9-[3-(4-methylpentylamino)propanoyloxy]nonyl 3-(hexylamino)propanoate?
9-[3-(4-methylpentylamino)propanoyloxy]nonyl 3-(hexylamino)propanoate has a molecular weight of 470.74 g/mol, XLogP of 5.78, 25 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[3-(4-methylpentylamino)propanoyloxy]nonyl 3-(hexylamino)propanoate is sourced from PubChem (CID 91449159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).