C19H37NO5Si — CID 170692689
(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3-(3-trimethoxysilylpropylamino)propanoate (PubChem CID 170692689) has the molecular formula C19H37NO5Si and a molecular weight of 387.59 g/mol. Its IUPAC name is (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3-(3-trimethoxysilylpropylamino)propanoate.
| Compound Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3-(3-trimethoxysilylpropylamino)propanoate |
|---|---|
| PubChem CID | 170692689 |
| Molecular Formula | C19H37NO5Si |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3-(3-trimethoxysilylpropylamino)propanoate |
| SMILES | CO[Si](CCCNCCC(=O)OC1CC2CCC1(C)C2(C)C)(OC)OC |
| InChI | InChI=1S/C19H37NO5Si/c1-18(2)15-8-10-19(18,3)16(14-15)25-17(21)9-12-20-11-7-13-26(22-4,23-5)24-6/h15-16,20H,7-14H2,1-6H3 |
| InChIKey | FZIHTKPXJBIALZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|