C26H44NO4+ — CID 25425263
dimethyl-[2-oxo-2-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]-[2-oxo-2-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]azanium (PubChem CID 25425263) has the molecular formula C26H44NO4+ and a molecular weight of 434.64 g/mol. Its IUPAC name is dimethyl-[2-oxo-2-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]-[2-oxo-2-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]azanium.
| Compound Name | dimethyl-[2-oxo-2-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]-[2-oxo-2-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]azanium |
|---|---|
| PubChem CID | 25425263 |
| Molecular Formula | C26H44NO4+ |
| Molecular Weight | 434.64 g/mol |
| Exact Mass | 434.33 |
| IUPAC Name | dimethyl-[2-oxo-2-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]-[2-oxo-2-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]azanium |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](OC(=O)C[N+](C)(C)CC(=O)O[C@@H]1C[C@@H]3CC[C@@]1(C)C3(C)C)C2 |
| InChI | InChI=1S/C26H44NO4/c1-23(2)17-9-11-25(23,5)19(13-17)30-21(28)15-27(7,8)16-22(29)31-20-14-18-10-12-26(20,6)24(18,3)4/h17-20H,9-16H2,1-8H3/q+1/t17-,18+,19+,20-,25+,26- |
| InChIKey | BCSKVRAVCGLWAX-DHAZPCEWSA-N |
| XLogP | 4.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.64 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|