C17H30NO2+ — CID 98132627
dimethyl-[2-oxo-2-[[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]-prop-2-enylazanium (PubChem CID 98132627) has the molecular formula C17H30NO2+ and a molecular weight of 280.43 g/mol. Its IUPAC name is dimethyl-[2-oxo-2-[[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]-prop-2-enylazanium.
| Compound Name | dimethyl-[2-oxo-2-[[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]-prop-2-enylazanium |
|---|---|
| PubChem CID | 98132627 |
| Molecular Formula | C17H30NO2+ |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | dimethyl-[2-oxo-2-[[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]-prop-2-enylazanium |
| SMILES | C=CC[N+](C)(C)CC(=O)O[C@H]1C[C@@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C17H30NO2/c1-7-10-18(5,6)12-15(19)20-14-11-13-8-9-17(14,4)16(13,2)3/h7,13-14H,1,8-12H2,2-6H3/q+1/t13-,14-,17-/m0/s1 |
| InChIKey | SLARZQHNLGEXOZ-ZQIUZPCESA-N |
| XLogP | 3.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|