C26H46NO3+ — CID 98476949
dimethyl-[2-oxo-2-[[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]-[2-[[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]azanium (PubChem CID 98476949) has the molecular formula C26H46NO3+ and a molecular weight of 420.66 g/mol. Its IUPAC name is dimethyl-[2-oxo-2-[[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]-[2-[[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]azanium.
| Compound Name | dimethyl-[2-oxo-2-[[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]-[2-[[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]azanium |
|---|---|
| PubChem CID | 98476949 |
| Molecular Formula | C26H46NO3+ |
| Molecular Weight | 420.66 g/mol |
| Exact Mass | 420.35 |
| IUPAC Name | dimethyl-[2-oxo-2-[[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]-[2-[[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]azanium |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@H](OCC[N+](C)(C)CC(=O)O[C@@H]1C[C@@H]3CC[C@]1(C)C3(C)C)C2 |
| InChI | InChI=1S/C26H46NO3/c1-23(2)18-9-11-25(23,5)20(15-18)29-14-13-27(7,8)17-22(28)30-21-16-19-10-12-26(21,6)24(19,3)4/h18-21H,9-17H2,1-8H3/q+1/t18-,19+,20-,21-,25+,26+/m1/s1 |
| InChIKey | ZKIHPMHVQZGSRY-RMFZKBONSA-N |
| XLogP | 5.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.66 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|