C26H48NO2+ — CID 25276894
dimethyl-[2-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]-[2-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]azanium (PubChem CID 25276894) has the molecular formula C26H48NO2+ and a molecular weight of 406.68 g/mol. Its IUPAC name is dimethyl-[2-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]-[2-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]azanium.
| Compound Name | dimethyl-[2-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]-[2-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]azanium |
|---|---|
| PubChem CID | 25276894 |
| Molecular Formula | C26H48NO2+ |
| Molecular Weight | 406.68 g/mol |
| Exact Mass | 406.37 |
| IUPAC Name | dimethyl-[2-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]-[2-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]azanium |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](OCC[N+](C)(C)CCO[C@@H]1C[C@@H]3CC[C@@]1(C)C3(C)C)C2 |
| InChI | InChI=1S/C26H48NO2/c1-23(2)19-9-11-25(23,5)21(17-19)28-15-13-27(7,8)14-16-29-22-18-20-10-12-26(22,6)24(20,3)4/h19-22H,9-18H2,1-8H3/q+1/t19-,20+,21+,22-,25+,26- |
| InChIKey | VZERPTZRZSESNZ-VOHHKHJGSA-N |
| XLogP | 5.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.68 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|