C12H22O — CID 174997448
(1S,4R)-2-ethoxy-1,7,7-trimethylbicyclo[2.2.1]heptane (PubChem CID 174997448) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is (1S,4R)-2-ethoxy-1,7,7-trimethylbicyclo[2.2.1]heptane.
| Compound Name | (1S,4R)-2-ethoxy-1,7,7-trimethylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 174997448 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | (1S,4R)-2-ethoxy-1,7,7-trimethylbicyclo[2.2.1]heptane |
| SMILES | CCOC1C[C@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C12H22O/c1-5-13-10-8-9-6-7-12(10,4)11(9,2)3/h9-10H,5-8H2,1-4H3/t9-,10?,12-/m1/s1 |
| InChIKey | FTRQTUIGTQZQBL-UPCOPKIUSA-N |
| XLogP | 3.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |