C20H38ClNO4 — CID 171669335
[2-(2-ethoxyethoxy)-2-oxoethyl]-dimethyl-[2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]ethyl]azanium chloride (PubChem CID 171669335) has the molecular formula C20H38ClNO4 and a molecular weight of 391.98 g/mol. Its IUPAC name is [2-(2-ethoxyethoxy)-2-oxoethyl]-dimethyl-[2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]ethyl]azanium chloride.
| Compound Name | [2-(2-ethoxyethoxy)-2-oxoethyl]-dimethyl-[2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]ethyl]azanium chloride |
|---|---|
| PubChem CID | 171669335 |
| Molecular Formula | C20H38ClNO4 |
| Molecular Weight | 391.98 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | [2-(2-ethoxyethoxy)-2-oxoethyl]-dimethyl-[2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]ethyl]azanium chloride |
| SMILES | CCOCCOC(=O)C[N+](C)(C)CCOC1CC2CCC1(C)C2(C)C.[Cl-] |
| InChI | InChI=1S/C20H38NO4.ClH/c1-7-23-12-13-25-18(22)15-21(5,6)10-11-24-17-14-16-8-9-20(17,4)19(16,2)3;/h16-17H,7-15H2,1-6H3;1H/q+1;/p-1 |
| InChIKey | HKQDOVDOBNRRBQ-UHFFFAOYSA-M |
| XLogP | -0.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.98 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|