C20H38NO3+ — CID 19915971
(2-butoxy-2-oxoethyl)-dimethyl-[2-[[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]azanium (PubChem CID 19915971) has the molecular formula C20H38NO3+ and a molecular weight of 340.53 g/mol. Its IUPAC name is (2-butoxy-2-oxoethyl)-dimethyl-[2-[[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]azanium.
| Compound Name | (2-butoxy-2-oxoethyl)-dimethyl-[2-[[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]azanium |
|---|---|
| PubChem CID | 19915971 |
| Molecular Formula | C20H38NO3+ |
| Molecular Weight | 340.53 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | (2-butoxy-2-oxoethyl)-dimethyl-[2-[[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]azanium |
| SMILES | CCCCOC(=O)C[N+](C)(C)CCO[C@@H]1C[C@@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C20H38NO3/c1-7-8-12-24-18(22)15-21(5,6)11-13-23-17-14-16-9-10-20(17,4)19(16,2)3/h16-17H,7-15H2,1-6H3/q+1/t16-,17+,20-/m0/s1 |
| InChIKey | UGPBZXADQRDUJR-QKLQHJQFSA-N |
| XLogP | 3.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|