C23H44NO3+ — CID 92533183
(2-heptoxy-2-oxoethyl)-dimethyl-[2-[[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]azanium (PubChem CID 92533183) has the molecular formula C23H44NO3+ and a molecular weight of 382.61 g/mol. Its IUPAC name is (2-heptoxy-2-oxoethyl)-dimethyl-[2-[[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]azanium.
| Compound Name | (2-heptoxy-2-oxoethyl)-dimethyl-[2-[[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]azanium |
|---|---|
| PubChem CID | 92533183 |
| Molecular Formula | C23H44NO3+ |
| Molecular Weight | 382.61 g/mol |
| Exact Mass | 382.33 |
| IUPAC Name | (2-heptoxy-2-oxoethyl)-dimethyl-[2-[[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]azanium |
| SMILES | CCCCCCCOC(=O)C[N+](C)(C)CCO[C@H]1C[C@@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C23H44NO3/c1-7-8-9-10-11-15-27-21(25)18-24(5,6)14-16-26-20-17-19-12-13-23(20,4)22(19,2)3/h19-20H,7-18H2,1-6H3/q+1/t19-,20-,23+/m0/s1 |
| InChIKey | NRQDIJMGRGMJSE-SXWKCWPCSA-N |
| XLogP | 4.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.61 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|