C15H28NO2+ — CID 19915989
trimethyl-[2-oxo-2-[[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]azanium (PubChem CID 19915989) has the molecular formula C15H28NO2+ and a molecular weight of 254.39 g/mol. Its IUPAC name is trimethyl-[2-oxo-2-[[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]azanium.
| Compound Name | trimethyl-[2-oxo-2-[[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]azanium |
|---|---|
| PubChem CID | 19915989 |
| Molecular Formula | C15H28NO2+ |
| Molecular Weight | 254.39 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | trimethyl-[2-oxo-2-[[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]azanium |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)[C@@H](OC(=O)C[N+](C)(C)C)C2 |
| InChI | InChI=1S/C15H28NO2/c1-14(2)11-7-8-15(14,3)12(9-11)18-13(17)10-16(4,5)6/h11-12H,7-10H2,1-6H3/q+1/t11-,12-,15-/m0/s1 |
| InChIKey | VYQNSMBYUGCTBM-HUBLWGQQSA-N |
| XLogP | 2.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|