C14H19Cl3O2 — CID 7437772
[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 3,4,4-trichlorobut-3-enoate (PubChem CID 7437772) has the molecular formula C14H19Cl3O2 and a molecular weight of 325.66 g/mol. Its IUPAC name is [(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 3,4,4-trichlorobut-3-enoate.
| Compound Name | [(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 3,4,4-trichlorobut-3-enoate |
|---|---|
| PubChem CID | 7437772 |
| Molecular Formula | C14H19Cl3O2 |
| Molecular Weight | 325.66 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | [(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 3,4,4-trichlorobut-3-enoate |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)[C@H](OC(=O)CC(Cl)=C(Cl)Cl)C2 |
| InChI | InChI=1S/C14H19Cl3O2/c1-13(2)8-4-5-14(13,3)10(6-8)19-11(18)7-9(15)12(16)17/h8,10H,4-7H2,1-3H3/t8-,10+,14+/m0/s1 |
| InChIKey | INCZUJUVFSJFCB-LLHLLMPMSA-N |
| XLogP | 5.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.66 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |