C15H26O3 — CID 78925584
(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3-ethoxypropanoate (PubChem CID 78925584) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3-ethoxypropanoate.
| Compound Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3-ethoxypropanoate |
|---|---|
| PubChem CID | 78925584 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3-ethoxypropanoate |
| SMILES | CCOCCC(=O)OC1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C15H26O3/c1-5-17-9-7-13(16)18-12-10-11-6-8-15(12,4)14(11,2)3/h11-12H,5-10H2,1-4H3 |
| InChIKey | PPDWVCMWLFYYPC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|