C19H30O4 — CID 174476747
[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 4-acetyl-4-methyl-5-oxohexanoate (PubChem CID 174476747) has the molecular formula C19H30O4 and a molecular weight of 322.44 g/mol. Its IUPAC name is [(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 4-acetyl-4-methyl-5-oxohexanoate.
| Compound Name | [(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 4-acetyl-4-methyl-5-oxohexanoate |
|---|---|
| PubChem CID | 174476747 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | [(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 4-acetyl-4-methyl-5-oxohexanoate |
| SMILES | CC(=O)C(C)(CCC(=O)OC1C[C@H]2CC[C@@]1(C)C2(C)C)C(C)=O |
| InChI | InChI=1S/C19H30O4/c1-12(20)18(5,13(2)21)9-8-16(22)23-15-11-14-7-10-19(15,6)17(14,3)4/h14-15H,7-11H2,1-6H3/t14-,15?,19-/m1/s1 |
| InChIKey | IAZMWUQMXBLDHF-NQUBZZJWSA-N |
| XLogP | 3.71 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|