C52H88N2O8 — CID 171051530
[(1S,2R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 11-[4,4-bis(3,7-dimethyloct-6-enoxy)butanoyloxy]-5-(4-imidazol-1-ylbutanoyloxy)undecanoate (PubChem CID 171051530) has the molecular formula C52H88N2O8 and a molecular weight of 869.28 g/mol. Its IUPAC name is [(1S,2R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 11-[4,4-bis(3,7-dimethyloct-6-enoxy)butanoyloxy]-5-(4-imidazol-1-ylbutanoyloxy)undecanoate.
| Compound Name | [(1S,2R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 11-[4,4-bis(3,7-dimethyloct-6-enoxy)butanoyloxy]-5-(4-imidazol-1-ylbutanoyloxy)undecanoate |
|---|---|
| PubChem CID | 171051530 |
| Molecular Formula | C52H88N2O8 |
| Molecular Weight | 869.28 g/mol |
| Exact Mass | 868.65 |
| IUPAC Name | [(1S,2R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 11-[4,4-bis(3,7-dimethyloct-6-enoxy)butanoyloxy]-5-(4-imidazol-1-ylbutanoyloxy)undecanoate |
| SMILES | CC(C)=CCCC(C)CCOC(CCC(=O)OCCCCCCC(CCCC(=O)O[C@@H]1CC2CC[C@@]1(C)C2(C)C)OC(=O)CCCn1ccnc1)OCCC(C)CCC=C(C)C |
| InChI | InChI=1S/C52H88N2O8/c1-40(2)18-14-20-42(5)29-36-59-50(60-37-30-43(6)21-15-19-41(3)4)27-26-47(55)58-35-13-11-10-12-22-45(61-48(56)25-17-33-54-34-32-53-39-54)23-16-24-49(57)62-46-38-44-28-31-52(46,9)51(44,7)8/h18-19,32,34,39,42-46,50H,10-17,20-31,33,35-38H2,1-9H3/t42?,43?,44?,45?,46-,50?,52-/m1/s1 |
| InChIKey | MAMYVHWYINCSCL-IHPNSPCESA-N |
| XLogP | 12.68 |
| TPSA | 115.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.28 |
| LogP ≤ 5 | 12.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|