C38H67N3O4 — CID 165381299
6-[6-(3,7-dimethyloct-6-enoyloxy)hexyl-(3-imidazol-1-ylpropyl)amino]hexyl 3,7-dimethyloct-6-enoate (PubChem CID 165381299) has the molecular formula C38H67N3O4 and a molecular weight of 629.97 g/mol. Its IUPAC name is 6-[6-(3,7-dimethyloct-6-enoyloxy)hexyl-(3-imidazol-1-ylpropyl)amino]hexyl 3,7-dimethyloct-6-enoate.
| Compound Name | 6-[6-(3,7-dimethyloct-6-enoyloxy)hexyl-(3-imidazol-1-ylpropyl)amino]hexyl 3,7-dimethyloct-6-enoate |
|---|---|
| PubChem CID | 165381299 |
| Molecular Formula | C38H67N3O4 |
| Molecular Weight | 629.97 g/mol |
| Exact Mass | 629.51 |
| IUPAC Name | 6-[6-(3,7-dimethyloct-6-enoyloxy)hexyl-(3-imidazol-1-ylpropyl)amino]hexyl 3,7-dimethyloct-6-enoate |
| SMILES | CC(C)=CCCC(C)CC(=O)OCCCCCCN(CCCCCCOC(=O)CC(C)CCC=C(C)C)CCCn1ccnc1 |
| InChI | InChI=1S/C38H67N3O4/c1-33(2)18-15-20-35(5)30-37(42)44-28-13-9-7-11-23-40(25-17-26-41-27-22-39-32-41)24-12-8-10-14-29-45-38(43)31-36(6)21-16-19-34(3)4/h18-19,22,27,32,35-36H,7-17,20-21,23-26,28-31H2,1-6H3 |
| InChIKey | GEQGYWCGWJACLR-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.97 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|