C32H59N3O2 — CID 170077527
7-[4-(2-methylimidazol-1-yl)butyl-pentylamino]heptyl 3,9-dimethyldec-8-enoate (PubChem CID 170077527) has the molecular formula C32H59N3O2 and a molecular weight of 517.84 g/mol. Its IUPAC name is 7-[4-(2-methylimidazol-1-yl)butyl-pentylamino]heptyl 3,9-dimethyldec-8-enoate.
| Compound Name | 7-[4-(2-methylimidazol-1-yl)butyl-pentylamino]heptyl 3,9-dimethyldec-8-enoate |
|---|---|
| PubChem CID | 170077527 |
| Molecular Formula | C32H59N3O2 |
| Molecular Weight | 517.84 g/mol |
| Exact Mass | 517.46 |
| IUPAC Name | 7-[4-(2-methylimidazol-1-yl)butyl-pentylamino]heptyl 3,9-dimethyldec-8-enoate |
| SMILES | CCCCCN(CCCCCCCOC(=O)CC(C)CCCCC=C(C)C)CCCCn1ccnc1C |
| InChI | InChI=1S/C32H59N3O2/c1-6-7-14-22-34(24-16-17-25-35-26-21-33-31(35)5)23-15-9-8-10-18-27-37-32(36)28-30(4)20-13-11-12-19-29(2)3/h19,21,26,30H,6-18,20,22-25,27-28H2,1-5H3 |
| InChIKey | KLMOKXVCVGXSFL-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.84 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|