C52H99N3O4 — CID 170076409
6-[6-(2-hexyldecanoyloxy)hexyl-[3-(2-methylimidazol-1-yl)propyl]amino]hexyl 2-heptyldecanoate (PubChem CID 170076409) has the molecular formula C52H99N3O4 and a molecular weight of 830.38 g/mol. Its IUPAC name is 6-[6-(2-hexyldecanoyloxy)hexyl-[3-(2-methylimidazol-1-yl)propyl]amino]hexyl 2-heptyldecanoate.
| Compound Name | 6-[6-(2-hexyldecanoyloxy)hexyl-[3-(2-methylimidazol-1-yl)propyl]amino]hexyl 2-heptyldecanoate |
|---|---|
| PubChem CID | 170076409 |
| Molecular Formula | C52H99N3O4 |
| Molecular Weight | 830.38 g/mol |
| Exact Mass | 829.76 |
| IUPAC Name | 6-[6-(2-hexyldecanoyloxy)hexyl-[3-(2-methylimidazol-1-yl)propyl]amino]hexyl 2-heptyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCCN(CCCCCCOC(=O)C(CCCCCCC)CCCCCCCC)CCCn1ccnc1C |
| InChI | InChI=1S/C52H99N3O4/c1-6-10-14-18-21-29-38-49(36-27-17-13-9-4)51(56)58-46-33-25-23-31-41-54(43-35-44-55-45-40-53-48(55)5)42-32-24-26-34-47-59-52(57)50(37-28-20-16-12-8-3)39-30-22-19-15-11-7-2/h40,45,49-50H,6-39,41-44,46-47H2,1-5H3 |
| InChIKey | HEJIQABFJJWZFB-UHFFFAOYSA-N |
| XLogP | 15.16 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.38 |
| LogP ≤ 5 | 15.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|