C29H59NO5 — CID 178070152
3,3-bis(7-methyloctoxy)propyl 6-(2-hydroxyethylamino)hexanoate (PubChem CID 178070152) has the molecular formula C29H59NO5 and a molecular weight of 501.79 g/mol. Its IUPAC name is 3,3-bis(7-methyloctoxy)propyl 6-(2-hydroxyethylamino)hexanoate.
| Compound Name | 3,3-bis(7-methyloctoxy)propyl 6-(2-hydroxyethylamino)hexanoate |
|---|---|
| PubChem CID | 178070152 |
| Molecular Formula | C29H59NO5 |
| Molecular Weight | 501.79 g/mol |
| Exact Mass | 501.44 |
| IUPAC Name | 3,3-bis(7-methyloctoxy)propyl 6-(2-hydroxyethylamino)hexanoate |
| SMILES | CC(C)CCCCCCOC(CCOC(=O)CCCCCNCCO)OCCCCCCC(C)C |
| InChI | InChI=1S/C29H59NO5/c1-26(2)16-10-5-7-14-23-34-29(35-24-15-8-6-11-17-27(3)4)19-25-33-28(32)18-12-9-13-20-30-21-22-31/h26-27,29-31H,5-25H2,1-4H3 |
| InChIKey | ZJVXQMFQEFVKTQ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.79 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|