C47H87NO12S — CID 172627016
2,3-bis[[10-[(3S)-3,7-dimethyloct-6-enoxy]-10-oxodecanoyl]oxy]propyl-trimethylazanium;methyl sulfate (PubChem CID 172627016) has the molecular formula C47H87NO12S and a molecular weight of 890.27 g/mol. Its IUPAC name is 2,3-bis[[10-[(3S)-3,7-dimethyloct-6-enoxy]-10-oxodecanoyl]oxy]propyl-trimethylazanium;methyl sulfate.
| Compound Name | 2,3-bis[[10-[(3S)-3,7-dimethyloct-6-enoxy]-10-oxodecanoyl]oxy]propyl-trimethylazanium;methyl sulfate |
|---|---|
| PubChem CID | 172627016 |
| Molecular Formula | C47H87NO12S |
| Molecular Weight | 890.27 g/mol |
| Exact Mass | 889.59 |
| IUPAC Name | 2,3-bis[[10-[(3S)-3,7-dimethyloct-6-enoxy]-10-oxodecanoyl]oxy]propyl-trimethylazanium;methyl sulfate |
| SMILES | CC(C)=CCC[C@H](C)CCOC(=O)CCCCCCCCC(=O)OCC(C[N+](C)(C)C)OC(=O)CCCCCCCCC(=O)OCC[C@@H](C)CCC=C(C)C.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C46H84NO8.CH4O4S/c1-38(2)24-22-26-40(5)32-34-52-43(48)28-18-14-10-11-16-20-30-45(50)54-37-42(36-47(7,8)9)55-46(51)31-21-17-13-12-15-19-29-44(49)53-35-33-41(6)27-23-25-39(3)4;1-5-6(2,3)4/h24-25,40-42H,10-23,26-37H2,1-9H3;1H3,(H,2,3,4)/q+1;/p-1/t40-,41-,42?;/m0./s1 |
| InChIKey | MGAVPUXEPMADSJ-BFAHYHRMSA-M |
| XLogP | 10.11 |
| TPSA | 171.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 890.27 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|