C23H43NO8S5 — CID 10121875
2,3-bis[5-(dithiolan-3-yl)pentanoyloxy]propyl-trimethylazanium;methyl sulfate (PubChem CID 10121875) has the molecular formula C23H43NO8S5 and a molecular weight of 621.93 g/mol. Its IUPAC name is 2,3-bis[5-(dithiolan-3-yl)pentanoyloxy]propyl-trimethylazanium;methyl sulfate.
| Compound Name | 2,3-bis[5-(dithiolan-3-yl)pentanoyloxy]propyl-trimethylazanium;methyl sulfate |
|---|---|
| PubChem CID | 10121875 |
| Molecular Formula | C23H43NO8S5 |
| Molecular Weight | 621.93 g/mol |
| Exact Mass | 621.16 |
| IUPAC Name | 2,3-bis[5-(dithiolan-3-yl)pentanoyloxy]propyl-trimethylazanium;methyl sulfate |
| SMILES | COS(=O)(=O)[O-].C[N+](C)(C)CC(COC(=O)CCCCC1CCSS1)OC(=O)CCCCC1CCSS1 |
| InChI | InChI=1S/C22H40NO4S4.CH4O4S/c1-23(2,3)16-18(27-22(25)11-7-5-9-20-13-15-29-31-20)17-26-21(24)10-6-4-8-19-12-14-28-30-19;1-5-6(2,3)4/h18-20H,4-17H2,1-3H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | HDLDUNYRAWRAIC-UHFFFAOYSA-M |
| XLogP | 4.67 |
| TPSA | 119.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.93 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|