C14H28O — CID 173253621
(6S)-2,6-dimethyl-8-(2-methylpropoxy)oct-2-ene (PubChem CID 173253621) has the molecular formula C14H28O and a molecular weight of 212.38 g/mol. Its IUPAC name is (6S)-2,6-dimethyl-8-(2-methylpropoxy)oct-2-ene.
| Compound Name | (6S)-2,6-dimethyl-8-(2-methylpropoxy)oct-2-ene |
|---|---|
| PubChem CID | 173253621 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | (6S)-2,6-dimethyl-8-(2-methylpropoxy)oct-2-ene |
| SMILES | CC(C)=CCC[C@H](C)CCOCC(C)C |
| InChI | InChI=1S/C14H28O/c1-12(2)7-6-8-14(5)9-10-15-11-13(3)4/h7,13-14H,6,8-11H2,1-5H3/t14-/m0/s1 |
| InChIKey | RVUNEIPEFGMXJA-AWEZNQCLSA-N |
| XLogP | 4.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|