C19H38O2 — CID 175023026
9-(3,7-dimethyloct-6-enoxy)nonan-1-ol (PubChem CID 175023026) has the molecular formula C19H38O2 and a molecular weight of 298.51 g/mol. Its IUPAC name is 9-(3,7-dimethyloct-6-enoxy)nonan-1-ol.
| Compound Name | 9-(3,7-dimethyloct-6-enoxy)nonan-1-ol |
|---|---|
| PubChem CID | 175023026 |
| Molecular Formula | C19H38O2 |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.29 |
| IUPAC Name | 9-(3,7-dimethyloct-6-enoxy)nonan-1-ol |
| SMILES | CC(C)=CCCC(C)CCOCCCCCCCCCO |
| InChI | InChI=1S/C19H38O2/c1-18(2)12-11-13-19(3)14-17-21-16-10-8-6-4-5-7-9-15-20/h12,19-20H,4-11,13-17H2,1-3H3 |
| InChIKey | VHTRBTRVRUTFEX-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|