C21H40O4 — CID 18544976
bis(3,7-dimethyloct-6-enoxy)methanediol (PubChem CID 18544976) has the molecular formula C21H40O4 and a molecular weight of 356.55 g/mol. Its IUPAC name is bis(3,7-dimethyloct-6-enoxy)methanediol.
| Compound Name | bis(3,7-dimethyloct-6-enoxy)methanediol |
|---|---|
| PubChem CID | 18544976 |
| Molecular Formula | C21H40O4 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.29 |
| IUPAC Name | bis(3,7-dimethyloct-6-enoxy)methanediol |
| SMILES | CC(C)=CCCC(C)CCOC(O)(O)OCCC(C)CCC=C(C)C |
| InChI | InChI=1S/C21H40O4/c1-17(2)9-7-11-19(5)13-15-24-21(22,23)25-16-14-20(6)12-8-10-18(3)4/h9-10,19-20,22-23H,7-8,11-16H2,1-6H3 |
| InChIKey | BSVNSFQVDLZEOY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|