C14H22N2O — CID 139618937
2-(3,7-dimethyloct-6-enoxy)pyrimidine (PubChem CID 139618937) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-(3,7-dimethyloct-6-enoxy)pyrimidine.
| Compound Name | 2-(3,7-dimethyloct-6-enoxy)pyrimidine |
|---|---|
| PubChem CID | 139618937 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 2-(3,7-dimethyloct-6-enoxy)pyrimidine |
| SMILES | CC(C)=CCCC(C)CCOc1ncccn1 |
| InChI | InChI=1S/C14H22N2O/c1-12(2)6-4-7-13(3)8-11-17-14-15-9-5-10-16-14/h5-6,9-10,13H,4,7-8,11H2,1-3H3 |
| InChIKey | IKBSUYMHNNNRCZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|