C16H25BO3 — CID 69379924
[4-[(3S)-3,7-dimethyloct-6-enoxy]phenyl]boronic acid (PubChem CID 69379924) has the molecular formula C16H25BO3 and a molecular weight of 276.19 g/mol. Its IUPAC name is [4-[(3S)-3,7-dimethyloct-6-enoxy]phenyl]boronic acid.
| Compound Name | [4-[(3S)-3,7-dimethyloct-6-enoxy]phenyl]boronic acid |
|---|---|
| PubChem CID | 69379924 |
| Molecular Formula | C16H25BO3 |
| Molecular Weight | 276.19 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | [4-[(3S)-3,7-dimethyloct-6-enoxy]phenyl]boronic acid |
| SMILES | CC(C)=CCC[C@H](C)CCOc1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C16H25BO3/c1-13(2)5-4-6-14(3)11-12-20-16-9-7-15(8-10-16)17(18)19/h5,7-10,14,18-19H,4,6,11-12H2,1-3H3/t14-/m0/s1 |
| InChIKey | GVPNNXAWVKXHKN-AWEZNQCLSA-N |
| XLogP | 2.52 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.19 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|