C19H25NO — CID 70351839
8-(3,7-dimethyloct-6-enoxy)quinoline (PubChem CID 70351839) has the molecular formula C19H25NO and a molecular weight of 283.42 g/mol. Its IUPAC name is 8-(3,7-dimethyloct-6-enoxy)quinoline.
| Compound Name | 8-(3,7-dimethyloct-6-enoxy)quinoline |
|---|---|
| PubChem CID | 70351839 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 8-(3,7-dimethyloct-6-enoxy)quinoline |
| SMILES | CC(C)=CCCC(C)CCOc1cccc2cccnc12 |
| InChI | InChI=1S/C19H25NO/c1-15(2)7-4-8-16(3)12-14-21-18-11-5-9-17-10-6-13-20-19(17)18/h5-7,9-11,13,16H,4,8,12,14H2,1-3H3 |
| InChIKey | IQSCYLWMGBKAKH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|