C10H19Br — CID 10900106
(6S)-8-bromo-2,6-dimethyloct-2-ene (PubChem CID 10900106) has the molecular formula C10H19Br and a molecular weight of 219.17 g/mol. Its IUPAC name is (6S)-8-bromo-2,6-dimethyloct-2-ene.
| Compound Name | (6S)-8-bromo-2,6-dimethyloct-2-ene |
|---|---|
| PubChem CID | 10900106 |
| Molecular Formula | C10H19Br |
| Molecular Weight | 219.17 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | (6S)-8-bromo-2,6-dimethyloct-2-ene |
| SMILES | CC(C)=CCC[C@H](C)CCBr |
| InChI | InChI=1S/C10H19Br/c1-9(2)5-4-6-10(3)7-8-11/h5,10H,4,6-8H2,1-3H3/t10-/m0/s1 |
| InChIKey | QPKCDMXLSDFCQD-JTQLQIEISA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.17 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|