C16H28 — CID 134982878
(2E,4E,8S)-3,8,12-trimethyltrideca-2,4,11-triene (PubChem CID 134982878) has the molecular formula C16H28 and a molecular weight of 220.40 g/mol. Its IUPAC name is (2E,4E,8S)-3,8,12-trimethyltrideca-2,4,11-triene.
| Compound Name | (2E,4E,8S)-3,8,12-trimethyltrideca-2,4,11-triene |
|---|---|
| PubChem CID | 134982878 |
| Molecular Formula | C16H28 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.22 |
| IUPAC Name | (2E,4E,8S)-3,8,12-trimethyltrideca-2,4,11-triene |
| SMILES | C/C=C(C)/C=C/CC[C@H](C)CCC=C(C)C |
| InChI | InChI=1S/C16H28/c1-6-15(4)11-7-8-12-16(5)13-9-10-14(2)3/h6-7,10-11,16H,8-9,12-13H2,1-5H3/b11-7+,15-6+/t16-/m0/s1 |
| InChIKey | VREQZWAQVKYCFI-BIZIOZEUSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|