C11H22Se — CID 101158479
(6S)-2,6-dimethyl-8-methylselanyloct-2-ene (PubChem CID 101158479) has the molecular formula C11H22Se and a molecular weight of 233.26 g/mol. Its IUPAC name is (6S)-2,6-dimethyl-8-methylselanyloct-2-ene.
| Compound Name | (6S)-2,6-dimethyl-8-methylselanyloct-2-ene |
|---|---|
| PubChem CID | 101158479 |
| Molecular Formula | C11H22Se |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | (6S)-2,6-dimethyl-8-methylselanyloct-2-ene |
| SMILES | C[Se]CC[C@@H](C)CCC=C(C)C |
| InChI | InChI=1S/C11H22Se/c1-10(2)6-5-7-11(3)8-9-12-4/h6,11H,5,7-9H2,1-4H3/t11-/m0/s1 |
| InChIKey | BGQWLZYZERKJSR-NSHDSACASA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|