C13H22O2 — CID 91218155
6,10-dimethylundec-9-ene-2,3-dione (PubChem CID 91218155) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is 6,10-dimethylundec-9-ene-2,3-dione.
| Compound Name | 6,10-dimethylundec-9-ene-2,3-dione |
|---|---|
| PubChem CID | 91218155 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 6,10-dimethylundec-9-ene-2,3-dione |
| SMILES | CC(=O)C(=O)CCC(C)CCC=C(C)C |
| InChI | InChI=1S/C13H22O2/c1-10(2)6-5-7-11(3)8-9-13(15)12(4)14/h6,11H,5,7-9H2,1-4H3 |
| InChIKey | RQTPJMMKLMGNQK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|