C22H40O2 — CID 87880909
4,8,13,17-tetramethyloctadec-16-ene-2,11-dione (PubChem CID 87880909) has the molecular formula C22H40O2 and a molecular weight of 336.56 g/mol. Its IUPAC name is 4,8,13,17-tetramethyloctadec-16-ene-2,11-dione.
| Compound Name | 4,8,13,17-tetramethyloctadec-16-ene-2,11-dione |
|---|---|
| PubChem CID | 87880909 |
| Molecular Formula | C22H40O2 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.30 |
| IUPAC Name | 4,8,13,17-tetramethyloctadec-16-ene-2,11-dione |
| SMILES | CC(=O)CC(C)CCCC(C)CCC(=O)CC(C)CCC=C(C)C |
| InChI | InChI=1S/C22H40O2/c1-17(2)9-7-11-20(5)16-22(24)14-13-18(3)10-8-12-19(4)15-21(6)23/h9,18-20H,7-8,10-16H2,1-6H3 |
| InChIKey | FNWLUUZSUJIEDF-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|