methyl (7R)-7,11-dimethyl-3-oxododec-10-enoate

C15H26O3 — CID 24853912

IUPACmethyl (7R)-7,11-dimethyl-3-oxododec-10-enoate
SMILESCOC(=O)CC(=O)CCC[C@@H](C)CCC=C(C)C
InChIInChI=1S/C15H26O3/c1-12(2)7-5-8-13(3)9-6-10-14(16)11-15(17)18-4/h7,13H,5-6,8-11H2,1-4H3/t13-/m0/s1
InChIKeyPKBMGNSKHVTISU-ZDUSSCGKSA-N
MW254.37 g/mol
LogP3.67
Rot. Bonds9

About methyl (7R)-7,11-dimethyl-3-oxododec-10-enoate

methyl (7R)-7,11-dimethyl-3-oxododec-10-enoate (PubChem CID 24853912) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is methyl (7R)-7,11-dimethyl-3-oxododec-10-enoate.

Molecular Properties

Compound Namemethyl (7R)-7,11-dimethyl-3-oxododec-10-enoate
PubChem CID24853912
Molecular FormulaC15H26O3
Molecular Weight254.37 g/mol
Exact Mass254.19
IUPAC Namemethyl (7R)-7,11-dimethyl-3-oxododec-10-enoate
SMILESCOC(=O)CC(=O)CCC[C@@H](C)CCC=C(C)C
InChIInChI=1S/C15H26O3/c1-12(2)7-5-8-13(3)9-6-10-14(16)11-15(17)18-4/h7,13H,5-6,8-11H2,1-4H3/t13-/m0/s1
InChIKeyPKBMGNSKHVTISU-ZDUSSCGKSA-N
XLogP3.67
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.37
LogP ≤ 53.67
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze methyl (7R)-7,11-dimethyl-3-oxododec-10-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (7R)-7,11-dimethyl-3-oxododec-10-enoate?
The IUPAC name of methyl (7R)-7,11-dimethyl-3-oxododec-10-enoate (CID 24853912) is methyl (7R)-7,11-dimethyl-3-oxododec-10-enoate.
What is the SMILES notation for methyl (7R)-7,11-dimethyl-3-oxododec-10-enoate?
The canonical SMILES for methyl (7R)-7,11-dimethyl-3-oxododec-10-enoate is COC(=O)CC(=O)CCC[C@@H](C)CCC=C(C)C.
What is the InChIKey of methyl (7R)-7,11-dimethyl-3-oxododec-10-enoate?
The InChIKey is PKBMGNSKHVTISU-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H26O3/c1-12(2)7-5-8-13(3)9-6-10-14(16)11-15(17)18-4/h7,13H,5-6,8-11H2,1-4H3/t13-/m0/s1.
What are the key properties of methyl (7R)-7,11-dimethyl-3-oxododec-10-enoate?
methyl (7R)-7,11-dimethyl-3-oxododec-10-enoate has a molecular weight of 254.37 g/mol, XLogP of 3.67, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (7R)-7,11-dimethyl-3-oxododec-10-enoate is sourced from PubChem (CID 24853912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).