C15H26O3 — CID 24853912
methyl (7R)-7,11-dimethyl-3-oxododec-10-enoate (PubChem CID 24853912) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is methyl (7R)-7,11-dimethyl-3-oxododec-10-enoate.
| Compound Name | methyl (7R)-7,11-dimethyl-3-oxododec-10-enoate |
|---|---|
| PubChem CID | 24853912 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | methyl (7R)-7,11-dimethyl-3-oxododec-10-enoate |
| SMILES | COC(=O)CC(=O)CCC[C@@H](C)CCC=C(C)C |
| InChI | InChI=1S/C15H26O3/c1-12(2)7-5-8-13(3)9-6-10-14(16)11-15(17)18-4/h7,13H,5-6,8-11H2,1-4H3/t13-/m0/s1 |
| InChIKey | PKBMGNSKHVTISU-ZDUSSCGKSA-N |
| XLogP | 3.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|