C15H28O — CID 71359316
8,12-dimethyltridec-11-en-4-one (PubChem CID 71359316) has the molecular formula C15H28O and a molecular weight of 224.39 g/mol. Its IUPAC name is 8,12-dimethyltridec-11-en-4-one.
| Compound Name | 8,12-dimethyltridec-11-en-4-one |
|---|---|
| PubChem CID | 71359316 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | 8,12-dimethyltridec-11-en-4-one |
| SMILES | CCCC(=O)CCCC(C)CCC=C(C)C |
| InChI | InChI=1S/C15H28O/c1-5-8-15(16)12-7-11-14(4)10-6-9-13(2)3/h9,14H,5-8,10-12H2,1-4H3 |
| InChIKey | TZIHPXRIDCAZMD-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|