C16H32O2 — CID 88603702
3,7-dimethyloct-6-en-1-ol;hexanal (PubChem CID 88603702) has the molecular formula C16H32O2 and a molecular weight of 256.43 g/mol. Its IUPAC name is 3,7-dimethyloct-6-en-1-ol;hexanal.
| Compound Name | 3,7-dimethyloct-6-en-1-ol;hexanal |
|---|---|
| PubChem CID | 88603702 |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | 3,7-dimethyloct-6-en-1-ol;hexanal |
| SMILES | CC(C)=CCCC(C)CCO.CCCCCC=O |
| InChI | InChI=1S/C10H20O.C6H12O/c1-9(2)5-4-6-10(3)7-8-11;1-2-3-4-5-6-7/h5,10-11H,4,6-8H2,1-3H3;6H,2-5H2,1H3 |
| InChIKey | SHHYYVWNQHFBFS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|