C16H32O5 — CID 174503934
acetic acid;butanoic acid;3,7-dimethyloct-6-en-1-ol (PubChem CID 174503934) has the molecular formula C16H32O5 and a molecular weight of 304.43 g/mol. Its IUPAC name is acetic acid;butanoic acid;3,7-dimethyloct-6-en-1-ol.
| Compound Name | acetic acid;butanoic acid;3,7-dimethyloct-6-en-1-ol |
|---|---|
| PubChem CID | 174503934 |
| Molecular Formula | C16H32O5 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | acetic acid;butanoic acid;3,7-dimethyloct-6-en-1-ol |
| SMILES | CC(=O)O.CC(C)=CCCC(C)CCO.CCCC(=O)O |
| InChI | InChI=1S/C10H20O.C4H8O2.C2H4O2/c1-9(2)5-4-6-10(3)7-8-11;1-2-3-4(5)6;1-2(3)4/h5,10-11H,4,6-8H2,1-3H3;2-3H2,1H3,(H,5,6);1H3,(H,3,4) |
| InChIKey | SLHPJJRGBKSGCR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|