C15H26O2 — CID 138968115
8,12-dimethyltridec-11-ene-3,6-dione (PubChem CID 138968115) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is 8,12-dimethyltridec-11-ene-3,6-dione.
| Compound Name | 8,12-dimethyltridec-11-ene-3,6-dione |
|---|---|
| PubChem CID | 138968115 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 8,12-dimethyltridec-11-ene-3,6-dione |
| SMILES | CCC(=O)CCC(=O)CC(C)CCC=C(C)C |
| InChI | InChI=1S/C15H26O2/c1-5-14(16)9-10-15(17)11-13(4)8-6-7-12(2)3/h7,13H,5-6,8-11H2,1-4H3 |
| InChIKey | ADIFKWOZRFFTMW-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|