C12H20O — CID 85299318
5,9-dimethyldeca-1,8-dien-3-one (PubChem CID 85299318) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is 5,9-dimethyldeca-1,8-dien-3-one.
| Compound Name | 5,9-dimethyldeca-1,8-dien-3-one |
|---|---|
| PubChem CID | 85299318 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 5,9-dimethyldeca-1,8-dien-3-one |
| SMILES | C=CC(=O)CC(C)CCC=C(C)C |
| InChI | InChI=1S/C12H20O/c1-5-12(13)9-11(4)8-6-7-10(2)3/h5,7,11H,1,6,8-9H2,2-4H3 |
| InChIKey | KYOANJMZZGECEW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|